C29H33N3O3 — CID 89381814
2-[3-[[1-(3-formyl-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2,3,5,6,7,8-hexahydronaphthalen-2-yl]oxymethyl]phenyl]guanidine (PubChem CID 89381814) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-[3-[[1-(3-formyl-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2,3,5,6,7,8-hexahydronaphthalen-2-yl]oxymethyl]phenyl]guanidine.
| Compound Name | 2-[3-[[1-(3-formyl-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2,3,5,6,7,8-hexahydronaphthalen-2-yl]oxymethyl]phenyl]guanidine |
|---|---|
| PubChem CID | 89381814 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 2-[3-[[1-(3-formyl-2-hydroxy-5,6,7,8-tetrahydronaphthalen-1-yl)-2,3,5,6,7,8-hexahydronaphthalen-2-yl]oxymethyl]phenyl]guanidine |
| SMILES | NC(N)=Nc1cccc(COC2CC=C3CCCCC3=C2c2c(O)c(C=O)cc3c2CCCC3)c1 |
| InChI | InChI=1S/C29H33N3O3/c30-29(31)32-22-9-5-6-18(14-22)17-35-25-13-12-19-7-1-3-10-23(19)26(25)27-24-11-4-2-8-20(24)15-21(16-33)28(27)34/h5-6,9,12,14-16,25,34H,1-4,7-8,10-11,13,17H2,(H4,30,31,32) |
| InChIKey | IFTXGKJZWHGHIL-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|