About 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate
2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate (PubChem CID 89381882) has the molecular formula C11H14F6O5
and a molecular weight of 340.22 g/mol. Its IUPAC name is 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate |
| PubChem CID | 89381882 |
| Molecular Formula | C11H14F6O5 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H14F6O5/c1-3-6(2)7(18)21-4-5-22-8(19)9(20,10(12,13)14)11(15,16)17/h6,20H,3-5H2,1-2H3 |
| InChIKey | RDFGOFNDRZQISM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate?
The IUPAC name of 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate (CID 89381882) is 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate.
What is the SMILES notation for 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate?
The canonical SMILES for 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate is CCC(C)C(=O)OCCOC(=O)C(O)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate?
The InChIKey is RDFGOFNDRZQISM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F6O5/c1-3-6(2)7(18)21-4-5-22-8(19)9(20,10(12,13)14)11(15,16)17/h6,20H,3-5H2,1-2H3.
What are the key properties of 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate?
2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate has a molecular weight of 340.22 g/mol, XLogP of 1.97, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoyl]oxyethyl 2-methylbutanoate is sourced from PubChem (CID 89381882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).