About 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione
3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione (PubChem CID 89382058) has the molecular formula C12H14O7
and a molecular weight of 270.24 g/mol. Its IUPAC name is 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione.
Molecular Properties
| Compound Name | 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione |
| PubChem CID | 89382058 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione |
| SMILES | COC(C1C(=O)OC(=O)C1C)C1C(=O)OC(=O)C1C |
| InChI | InChI=1S/C12H14O7/c1-4-6(11(15)18-9(4)13)8(17-3)7-5(2)10(14)19-12(7)16/h4-8H,1-3H3 |
| InChIKey | ZKYBZJVQQUUGOT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione?
The IUPAC name of 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione (CID 89382058) is 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione.
What is the SMILES notation for 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione?
The canonical SMILES for 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione is COC(C1C(=O)OC(=O)C1C)C1C(=O)OC(=O)C1C.
What is the InChIKey of 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione?
The InChIKey is ZKYBZJVQQUUGOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O7/c1-4-6(11(15)18-9(4)13)8(17-3)7-5(2)10(14)19-12(7)16/h4-8H,1-3H3.
What are the key properties of 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione?
3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione has a molecular weight of 270.24 g/mol, XLogP of -0.33, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methoxy-(4-methyl-2,5-dioxooxolan-3-yl)methyl]-4-methyloxolane-2,5-dione is sourced from PubChem (CID 89382058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).