C22H22ClN5O4 — CID 89382308
2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chloroimidazo[1,5-a]pyrimidin-6-yl]-2-oxoacetic acid (PubChem CID 89382308) has the molecular formula C22H22ClN5O4 and a molecular weight of 455.90 g/mol. Its IUPAC name is 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chloroimidazo[1,5-a]pyrimidin-6-yl]-2-oxoacetic acid.
| Compound Name | 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chloroimidazo[1,5-a]pyrimidin-6-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 89382308 |
| Molecular Formula | C22H22ClN5O4 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chloroimidazo[1,5-a]pyrimidin-6-yl]-2-oxoacetic acid |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@@H](C)CN1C(=O)c1cn2c(C(=O)C(=O)O)ncc2nc1Cl |
| InChI | InChI=1S/C22H22ClN5O4/c1-13-10-27(14(2)9-26(13)11-15-6-4-3-5-7-15)21(30)16-12-28-17(25-19(16)23)8-24-20(28)18(29)22(31)32/h3-8,12-14H,9-11H2,1-2H3,(H,31,32)/t13-,14+/m0/s1 |
| InChIKey | MSPAUOMFZOCUDQ-UONOGXRCSA-N |
| XLogP | 2.38 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|