C24H25ClN4O4 — CID 89382411
2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chloro-6-methylpyrrolo[3,4-b]pyridin-5-yl]-2-oxoacetic acid (PubChem CID 89382411) has the molecular formula C24H25ClN4O4 and a molecular weight of 468.94 g/mol. Its IUPAC name is 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chloro-6-methylpyrrolo[3,4-b]pyridin-5-yl]-2-oxoacetic acid.
| Compound Name | 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chloro-6-methylpyrrolo[3,4-b]pyridin-5-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 89382411 |
| Molecular Formula | C24H25ClN4O4 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-[3-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-2-chloro-6-methylpyrrolo[3,4-b]pyridin-5-yl]-2-oxoacetic acid |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@@H](C)CN1C(=O)c1cc2c(C(=O)C(=O)O)n(C)cc2nc1Cl |
| InChI | InChI=1S/C24H25ClN4O4/c1-14-11-29(15(2)10-28(14)12-16-7-5-4-6-8-16)23(31)18-9-17-19(26-22(18)25)13-27(3)20(17)21(30)24(32)33/h4-9,13-15H,10-12H2,1-3H3,(H,32,33)/t14-,15+/m0/s1 |
| InChIKey | UWLFWMIOGGRXCM-LSDHHAIUSA-N |
| XLogP | 3.23 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|