C11H17N3 — CID 89382550
2-(5,6-dihydropyrrolo[2,3-b]pyridin-1-yl)-N,N-dimethylethanamine (PubChem CID 89382550) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-(5,6-dihydropyrrolo[2,3-b]pyridin-1-yl)-N,N-dimethylethanamine.
| Compound Name | 2-(5,6-dihydropyrrolo[2,3-b]pyridin-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 89382550 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-(5,6-dihydropyrrolo[2,3-b]pyridin-1-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCn1ccc2c1=NCCC=2 |
| InChI | InChI=1S/C11H17N3/c1-13(2)8-9-14-7-5-10-4-3-6-12-11(10)14/h4-5,7H,3,6,8-9H2,1-2H3 |
| InChIKey | OXADKSPCHOQMNR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|