C26H52O5Si2 — CID 89382844
(2S,3R,4Z,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyl-3-triethylsilyloxydeca-4,9-dienoic acid (PubChem CID 89382844) has the molecular formula C26H52O5Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is (2S,3R,4Z,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyl-3-triethylsilyloxydeca-4,9-dienoic acid.
| Compound Name | (2S,3R,4Z,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyl-3-triethylsilyloxydeca-4,9-dienoic acid |
|---|---|
| PubChem CID | 89382844 |
| Molecular Formula | C26H52O5Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (2S,3R,4Z,6R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-2,4,6-trimethyl-3-triethylsilyloxydeca-4,9-dienoic acid |
| SMILES | C=C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(/C)[C@H](O[Si](CC)(CC)CC)[C@H](C)C(=O)O |
| InChI | InChI=1S/C26H52O5Si2/c1-14-22(29-11)24(30-32(12,13)26(8,9)10)20(6)18-19(5)23(21(7)25(27)28)31-33(15-2,16-3)17-4/h14,18,20-24H,1,15-17H2,2-13H3,(H,27,28)/b19-18-/t20-,21+,22+,23+,24+/m1/s1 |
| InChIKey | XCHMFYHHUCRQNT-VLPXPOHBSA-N |
| XLogP | 7.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|