C20H22S — CID 89383397
2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methylidenethiopyran (PubChem CID 89383397) has the molecular formula C20H22S and a molecular weight of 294.46 g/mol. Its IUPAC name is 2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methylidenethiopyran.
| Compound Name | 2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methylidenethiopyran |
|---|---|
| PubChem CID | 89383397 |
| Molecular Formula | C20H22S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-[(1E,3Z,5Z)-hepta-1,3,5-trienyl]-4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-6-methylidenethiopyran |
| SMILES | C=C1C=C(C(=C)/C=C\C=C/C)C=C(/C=C/C=C\C=C/C)S1 |
| InChI | InChI=1S/C20H22S/c1-5-7-9-10-12-14-20-16-19(15-18(4)21-20)17(3)13-11-8-6-2/h5-16H,3-4H2,1-2H3/b7-5-,8-6-,10-9-,13-11-,14-12+ |
| InChIKey | IZUYWZOZYZOEBQ-ISDKJXRSSA-N |
| XLogP | 6.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|