C24H18F3IN2O3 — CID 89383534
[3-[[4-(iodomethyl)phenyl]methoxy]-2-(2,2,2-trifluoroethoxy)phenyl]-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone (PubChem CID 89383534) has the molecular formula C24H18F3IN2O3 and a molecular weight of 566.32 g/mol. Its IUPAC name is [3-[[4-(iodomethyl)phenyl]methoxy]-2-(2,2,2-trifluoroethoxy)phenyl]-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone.
| Compound Name | [3-[[4-(iodomethyl)phenyl]methoxy]-2-(2,2,2-trifluoroethoxy)phenyl]-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
|---|---|
| PubChem CID | 89383534 |
| Molecular Formula | C24H18F3IN2O3 |
| Molecular Weight | 566.32 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | [3-[[4-(iodomethyl)phenyl]methoxy]-2-(2,2,2-trifluoroethoxy)phenyl]-(1H-pyrrolo[2,3-b]pyridin-3-yl)methanone |
| SMILES | O=C(c1cccc(OCc2ccc(CI)cc2)c1OCC(F)(F)F)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C24H18F3IN2O3/c25-24(26,27)14-33-22-18(21(31)19-12-30-23-17(19)4-2-10-29-23)3-1-5-20(22)32-13-16-8-6-15(11-28)7-9-16/h1-10,12H,11,13-14H2,(H,29,30) |
| InChIKey | IZHIGBKTLKPMAA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.32 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|