About (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide
(E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide (PubChem CID 89383546) has the molecular formula C13H22N2
and a molecular weight of 206.33 g/mol. Its IUPAC name is (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide.
Molecular Properties
| Compound Name | (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide |
| PubChem CID | 89383546 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide |
| SMILES | C/C=C(C(\N)=N\C=C\C)/C(C)C/C=C/C |
| InChI | InChI=1S/C13H22N2/c1-5-8-9-11(4)12(7-3)13(14)15-10-6-2/h5-8,10-11H,9H2,1-4H3,(H2,14,15)/b8-5+,10-6+,12-7- |
| InChIKey | RVABMOGMBLHOSJ-SUTBHCIPSA-N |
| XLogP | 3.43 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide?
The IUPAC name of (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide (CID 89383546) is (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide.
What is the SMILES notation for (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide?
The canonical SMILES for (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide is C/C=C(C(\N)=N\C=C\C)/C(C)C/C=C/C.
What is the InChIKey of (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide?
The InChIKey is RVABMOGMBLHOSJ-SUTBHCIPSA-N. The full InChI is InChI=1S/C13H22N2/c1-5-8-9-11(4)12(7-3)13(14)15-10-6-2/h5-8,10-11H,9H2,1-4H3,(H2,14,15)/b8-5+,10-6+,12-7-.
What are the key properties of (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide?
(E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide has a molecular weight of 206.33 g/mol, XLogP of 3.43, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2Z)-2-ethylidene-3-methyl-N'-[(E)-prop-1-enyl]hept-5-enimidamide is sourced from PubChem (CID 89383546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).