C12H15F9O — CID 89383559
1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1-trifluoropropan-2-yl)cyclohexyl]propan-2-ol (PubChem CID 89383559) has the molecular formula C12H15F9O and a molecular weight of 346.23 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1-trifluoropropan-2-yl)cyclohexyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1-trifluoropropan-2-yl)cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 89383559 |
| Molecular Formula | C12H15F9O |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1-trifluoropropan-2-yl)cyclohexyl]propan-2-ol |
| SMILES | CC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C12H15F9O/c1-6(10(13,14)15)7-2-4-8(5-3-7)9(22,11(16,17)18)12(19,20)21/h6-8,22H,2-5H2,1H3 |
| InChIKey | WOCLITRFIUCBCL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |