About methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate
methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate (PubChem CID 89383763) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate.
Molecular Properties
| Compound Name | methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate |
| PubChem CID | 89383763 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate |
| SMILES | COC(=O)CCOC1C=C(C)C=CC1 |
| InChI | InChI=1S/C11H16O3/c1-9-4-3-5-10(8-9)14-7-6-11(12)13-2/h3-4,8,10H,5-7H2,1-2H3 |
| InChIKey | JOGMJMLYORLVEH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate?
The IUPAC name of methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate (CID 89383763) is methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate.
What is the SMILES notation for methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate?
The canonical SMILES for methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate is COC(=O)CCOC1C=C(C)C=CC1.
What is the InChIKey of methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate?
The InChIKey is JOGMJMLYORLVEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-9-4-3-5-10(8-9)14-7-6-11(12)13-2/h3-4,8,10H,5-7H2,1-2H3.
What are the key properties of methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate?
methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate has a molecular weight of 196.25 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-methylcyclohexa-2,4-dien-1-yl)oxypropanoate is sourced from PubChem (CID 89383763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).