C24H25N5O6S — CID 89383823
prop-2-enyl 2-cyano-3-[3-ethyl-5-[2-[[6-[[2-(2-methoxyethoxy)acetyl]amino]-2-pyridinyl]amino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enoate (PubChem CID 89383823) has the molecular formula C24H25N5O6S and a molecular weight of 511.56 g/mol. Its IUPAC name is prop-2-enyl 2-cyano-3-[3-ethyl-5-[2-[[6-[[2-(2-methoxyethoxy)acetyl]amino]-2-pyridinyl]amino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enoate.
| Compound Name | prop-2-enyl 2-cyano-3-[3-ethyl-5-[2-[[6-[[2-(2-methoxyethoxy)acetyl]amino]-2-pyridinyl]amino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enoate |
|---|---|
| PubChem CID | 89383823 |
| Molecular Formula | C24H25N5O6S |
| Molecular Weight | 511.56 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | prop-2-enyl 2-cyano-3-[3-ethyl-5-[2-[[6-[[2-(2-methoxyethoxy)acetyl]amino]-2-pyridinyl]amino]ethenylidene]-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enoate |
| SMILES | C=CCOC(=O)C(=C=c1sc(=C=CNc2cccc(NC(=O)COCCOC)n2)c(=O)n1CC)C#N |
| InChI | InChI=1S/C24H25N5O6S/c1-4-11-35-24(32)17(15-25)14-22-29(5-2)23(31)18(36-22)9-10-26-19-7-6-8-20(27-19)28-21(30)16-34-13-12-33-3/h4,6-8,10H,1,5,11-13,16H2,2-3H3,(H2,26,27,28,30) |
| InChIKey | PZEZNJUPEIBPHM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.56 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|