C29H26N6O3S — CID 89384050
2-cyano-N-(cyanomethyl)-3-[5-[2-[3-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]anilino]ethenylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enamide (PubChem CID 89384050) has the molecular formula C29H26N6O3S and a molecular weight of 538.63 g/mol. Its IUPAC name is 2-cyano-N-(cyanomethyl)-3-[5-[2-[3-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]anilino]ethenylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enamide.
| Compound Name | 2-cyano-N-(cyanomethyl)-3-[5-[2-[3-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]anilino]ethenylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enamide |
|---|---|
| PubChem CID | 89384050 |
| Molecular Formula | C29H26N6O3S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.18 |
| IUPAC Name | 2-cyano-N-(cyanomethyl)-3-[5-[2-[3-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]anilino]ethenylidene]-3-ethyl-4-oxo-1,3-thiazolidin-2-ylidene]prop-2-enamide |
| SMILES | CCn1c(=C=C(C#N)C(=O)NCC#N)sc(=C=CNc2cccc(CCN3CCOc4ccccc43)c2)c1=O |
| InChI | InChI=1S/C29H26N6O3S/c1-2-35-27(19-22(20-31)28(36)33-14-12-30)39-26(29(35)37)10-13-32-23-7-5-6-21(18-23)11-15-34-16-17-38-25-9-4-3-8-24(25)34/h3-9,13,18,32H,2,11,14-17H2,1H3,(H,33,36) |
| InChIKey | ZBCJQHIJTOUJHF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|