C25H31IN4O4 — CID 89384213
ethyl 6-(cyclohexylcarbamoyl)-5-[[2-(iodomethyl)phenyl]methyl]-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-2-carboxylate (PubChem CID 89384213) has the molecular formula C25H31IN4O4 and a molecular weight of 578.45 g/mol. Its IUPAC name is ethyl 6-(cyclohexylcarbamoyl)-5-[[2-(iodomethyl)phenyl]methyl]-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-2-carboxylate.
| Compound Name | ethyl 6-(cyclohexylcarbamoyl)-5-[[2-(iodomethyl)phenyl]methyl]-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 89384213 |
| Molecular Formula | C25H31IN4O4 |
| Molecular Weight | 578.45 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | ethyl 6-(cyclohexylcarbamoyl)-5-[[2-(iodomethyl)phenyl]methyl]-6-methyl-4-oxo-7H-pyrazolo[1,5-a]pyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2n(n1)CC(C)(C(=O)NC1CCCCC1)N(Cc1ccccc1CI)C2=O |
| InChI | InChI=1S/C25H31IN4O4/c1-3-34-23(32)20-13-21-22(31)29(15-18-10-8-7-9-17(18)14-26)25(2,16-30(21)28-20)24(33)27-19-11-5-4-6-12-19/h7-10,13,19H,3-6,11-12,14-16H2,1-2H3,(H,27,33) |
| InChIKey | LWXIUZXODLIWKL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|