C15H17NO2S — CID 89384402
(2R,4aS)-2-cyclohexa-1,5-dien-1-yl-7-sulfanyloxy-1,2,4a,8a-tetrahydroquinolin-4-ol (PubChem CID 89384402) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is (2R,4aS)-2-cyclohexa-1,5-dien-1-yl-7-sulfanyloxy-1,2,4a,8a-tetrahydroquinolin-4-ol.
| Compound Name | (2R,4aS)-2-cyclohexa-1,5-dien-1-yl-7-sulfanyloxy-1,2,4a,8a-tetrahydroquinolin-4-ol |
|---|---|
| PubChem CID | 89384402 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (2R,4aS)-2-cyclohexa-1,5-dien-1-yl-7-sulfanyloxy-1,2,4a,8a-tetrahydroquinolin-4-ol |
| SMILES | OC1=C[C@H](C2=CCCC=C2)NC2C=C(OS)C=C[C@H]12 |
| InChI | InChI=1S/C15H17NO2S/c17-15-9-13(10-4-2-1-3-5-10)16-14-8-11(18-19)6-7-12(14)15/h2,4-9,12-14,16-17,19H,1,3H2/t12-,13+,14?/m0/s1 |
| InChIKey | FIJWHWHPMHQOBN-WLDKUNSKSA-N |
| XLogP | 2.98 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|