C9H13N — CID 89384669
(6R)-6-methyl-2,3,5,6-tetrahydroindolizine (PubChem CID 89384669) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is (6R)-6-methyl-2,3,5,6-tetrahydroindolizine.
| Compound Name | (6R)-6-methyl-2,3,5,6-tetrahydroindolizine |
|---|---|
| PubChem CID | 89384669 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | (6R)-6-methyl-2,3,5,6-tetrahydroindolizine |
| SMILES | C[C@@H]1C=CC2=CCCN2C1 |
| InChI | InChI=1S/C9H13N/c1-8-4-5-9-3-2-6-10(9)7-8/h3-5,8H,2,6-7H2,1H3/t8-/m1/s1 |
| InChIKey | VMFYHABKNLMMQT-MRVPVSSYSA-N |
| XLogP | 1.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |