About N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine
N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine (PubChem CID 89384757) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine.
Molecular Properties
| Compound Name | N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine |
| PubChem CID | 89384757 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine |
| SMILES | CCc1nc(C)nc(NO)n1 |
| InChI | InChI=1S/C6H10N4O/c1-3-5-7-4(2)8-6(9-5)10-11/h11H,3H2,1-2H3,(H,7,8,9,10) |
| InChIKey | LMDSPQSPEKDNLX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine?
The IUPAC name of N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine (CID 89384757) is N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine.
What is the SMILES notation for N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine?
The canonical SMILES for N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine is CCc1nc(C)nc(NO)n1.
What is the InChIKey of N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine?
The InChIKey is LMDSPQSPEKDNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-3-5-7-4(2)8-6(9-5)10-11/h11H,3H2,1-2H3,(H,7,8,9,10).
What are the key properties of N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine?
N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine has a molecular weight of 154.17 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-ethyl-6-methyl-1,3,5-triazin-2-yl)hydroxylamine is sourced from PubChem (CID 89384757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).