C12H20BIO3PS+ — CID 89384772
2-[(2R,3R,4R,5R,6R)-4-hydroxy-6-[(E)-1-iodoprop-1-en-2-yl]-3,5-dimethyloxan-2-yl]ethoxyboranylidene-sulfanylidenephosphanium (PubChem CID 89384772) has the molecular formula C12H20BIO3PS+ and a molecular weight of 413.05 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R,6R)-4-hydroxy-6-[(E)-1-iodoprop-1-en-2-yl]-3,5-dimethyloxan-2-yl]ethoxyboranylidene-sulfanylidenephosphanium.
| Compound Name | 2-[(2R,3R,4R,5R,6R)-4-hydroxy-6-[(E)-1-iodoprop-1-en-2-yl]-3,5-dimethyloxan-2-yl]ethoxyboranylidene-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 89384772 |
| Molecular Formula | C12H20BIO3PS+ |
| Molecular Weight | 413.05 g/mol |
| Exact Mass | 413.00 |
| IUPAC Name | 2-[(2R,3R,4R,5R,6R)-4-hydroxy-6-[(E)-1-iodoprop-1-en-2-yl]-3,5-dimethyloxan-2-yl]ethoxyboranylidene-sulfanylidenephosphanium |
| SMILES | C/C(=C\I)[C@@H]1O[C@H](CCOB=[P+]=S)[C@H](C)[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C12H20BIO3PS/c1-7(6-14)12-9(3)11(15)8(2)10(17-12)4-5-16-13-18-19/h6,8-12,15H,4-5H2,1-3H3/q+1/b7-6+/t8-,9+,10+,11+,12-/m0/s1 |
| InChIKey | YWGGUZKMOIFLSH-PLYWBUAHSA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.05 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|