About 8-methyl-6,7-dihydro-4H-1,3-benzodioxine
8-methyl-6,7-dihydro-4H-1,3-benzodioxine (PubChem CID 89384807) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 8-methyl-6,7-dihydro-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 8-methyl-6,7-dihydro-4H-1,3-benzodioxine |
| PubChem CID | 89384807 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 8-methyl-6,7-dihydro-4H-1,3-benzodioxine |
| SMILES | CC1=C2OCOCC2=CCC1 |
| InChI | InChI=1S/C9H12O2/c1-7-3-2-4-8-5-10-6-11-9(7)8/h4H,2-3,5-6H2,1H3 |
| InChIKey | JDURUAWWYXXBOJ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-6,7-dihydro-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6,7-dihydro-4H-1,3-benzodioxine?
The IUPAC name of 8-methyl-6,7-dihydro-4H-1,3-benzodioxine (CID 89384807) is 8-methyl-6,7-dihydro-4H-1,3-benzodioxine.
What is the SMILES notation for 8-methyl-6,7-dihydro-4H-1,3-benzodioxine?
The canonical SMILES for 8-methyl-6,7-dihydro-4H-1,3-benzodioxine is CC1=C2OCOCC2=CCC1.
What is the InChIKey of 8-methyl-6,7-dihydro-4H-1,3-benzodioxine?
The InChIKey is JDURUAWWYXXBOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-7-3-2-4-8-5-10-6-11-9(7)8/h4H,2-3,5-6H2,1H3.
What are the key properties of 8-methyl-6,7-dihydro-4H-1,3-benzodioxine?
8-methyl-6,7-dihydro-4H-1,3-benzodioxine has a molecular weight of 152.19 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6,7-dihydro-4H-1,3-benzodioxine is sourced from PubChem (CID 89384807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).