About (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine
(4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine (PubChem CID 89385029) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine.
Molecular Properties
| Compound Name | (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine |
| PubChem CID | 89385029 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine |
| SMILES | C=C/C=C\C[C@@]1(C)C=CN=CC1 |
| InChI | InChI=1S/C11H15N/c1-3-4-5-6-11(2)7-9-12-10-8-11/h3-5,7,9-10H,1,6,8H2,2H3/b5-4-/t11-/m0/s1 |
| InChIKey | MGBIFFRSZVIXBO-WYGGZMRJSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine?
The IUPAC name of (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine (CID 89385029) is (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine.
What is the SMILES notation for (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine?
The canonical SMILES for (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine is C=C/C=C\C[C@@]1(C)C=CN=CC1.
What is the InChIKey of (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine?
The InChIKey is MGBIFFRSZVIXBO-WYGGZMRJSA-N. The full InChI is InChI=1S/C11H15N/c1-3-4-5-6-11(2)7-9-12-10-8-11/h3-5,7,9-10H,1,6,8H2,2H3/b5-4-/t11-/m0/s1.
What are the key properties of (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine?
(4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine has a molecular weight of 161.25 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-methyl-4-[(2Z)-penta-2,4-dienyl]-3H-pyridine is sourced from PubChem (CID 89385029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).