About 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine
5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine (PubChem CID 89385260) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine |
| PubChem CID | 89385260 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine |
| SMILES | C=C/C=C\C1=C(C)OCCC1N |
| InChI | InChI=1S/C10H15NO/c1-3-4-5-9-8(2)12-7-6-10(9)11/h3-5,10H,1,6-7,11H2,2H3/b5-4- |
| InChIKey | ZWZXDBRBYMZGLA-PLNGDYQASA-N |
| XLogP | 1.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine (CID 89385260) is 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine is C=C/C=C\C1=C(C)OCCC1N.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine?
The InChIKey is ZWZXDBRBYMZGLA-PLNGDYQASA-N. The full InChI is InChI=1S/C10H15NO/c1-3-4-5-9-8(2)12-7-6-10(9)11/h3-5,10H,1,6-7,11H2,2H3/b5-4-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine?
5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine has a molecular weight of 165.24 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-6-methyl-3,4-dihydro-2H-pyran-4-amine is sourced from PubChem (CID 89385260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).