About 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol
6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol (PubChem CID 89385278) has the molecular formula C16H24O6
and a molecular weight of 312.36 g/mol. Its IUPAC name is 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol.
Molecular Properties
| Compound Name | 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol |
| PubChem CID | 89385278 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol |
| SMILES | OC1CC2CC(COCCOCC3CC4OC3C3OC43)C1O2 |
| InChI | InChI=1S/C16H24O6/c17-11-5-10-3-8(13(11)20-10)6-18-1-2-19-7-9-4-12-15-16(22-15)14(9)21-12/h8-17H,1-7H2 |
| InChIKey | GFMZOABPHNREQL-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol?
The IUPAC name of 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol (CID 89385278) is 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol.
What is the SMILES notation for 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol?
The canonical SMILES for 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol is OC1CC2CC(COCCOCC3CC4OC3C3OC43)C1O2.
What is the InChIKey of 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol?
The InChIKey is GFMZOABPHNREQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O6/c17-11-5-10-3-8(13(11)20-10)6-18-1-2-19-7-9-4-12-15-16(22-15)14(9)21-12/h8-17H,1-7H2.
What are the key properties of 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol?
6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol has a molecular weight of 312.36 g/mol, XLogP of 0.11, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3,8-dioxatricyclo[3.2.1.02,4]octan-6-ylmethoxy)ethoxymethyl]-7-oxabicyclo[2.2.1]heptan-2-ol is sourced from PubChem (CID 89385278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).