C21H26ClNO2 — CID 89385547
N-benzyl-2-chloro-N-[[(4S,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]methyl]ethanamine (PubChem CID 89385547) has the molecular formula C21H26ClNO2 and a molecular weight of 359.90 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[[(4S,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]methyl]ethanamine.
| Compound Name | N-benzyl-2-chloro-N-[[(4S,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 89385547 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-benzyl-2-chloro-N-[[(4S,5R)-2,2-dimethyl-5-phenyl-1,3-dioxolan-4-yl]methyl]ethanamine |
| SMILES | CC1(C)O[C@@H](CN(CCCl)Cc2ccccc2)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C21H26ClNO2/c1-21(2)24-19(20(25-21)18-11-7-4-8-12-18)16-23(14-13-22)15-17-9-5-3-6-10-17/h3-12,19-20H,13-16H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | BDFSYAKOUNLGSR-VQTJNVASSA-N |
| XLogP | 4.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|