C25H32FN3 — CID 89385598
(1Z,4Z)-2-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]-1-(4-fluorophenyl)-1-N-methyl-5-(prop-2-enylideneamino)penta-1,4-diene-1,2-diamine (PubChem CID 89385598) has the molecular formula C25H32FN3 and a molecular weight of 393.55 g/mol. Its IUPAC name is (1Z,4Z)-2-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]-1-(4-fluorophenyl)-1-N-methyl-5-(prop-2-enylideneamino)penta-1,4-diene-1,2-diamine.
| Compound Name | (1Z,4Z)-2-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]-1-(4-fluorophenyl)-1-N-methyl-5-(prop-2-enylideneamino)penta-1,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 89385598 |
| Molecular Formula | C25H32FN3 |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | (1Z,4Z)-2-N-[(4Z,5Z)-4-ethylideneocta-5,7-dienyl]-1-(4-fluorophenyl)-1-N-methyl-5-(prop-2-enylideneamino)penta-1,4-diene-1,2-diamine |
| SMILES | C=C/C=C\C(=C/C)CCCN/C(C/C=C\N=C\C=C)=C(\NC)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H32FN3/c1-5-8-11-21(7-3)12-9-20-29-24(13-10-19-28-18-6-2)25(27-4)22-14-16-23(26)17-15-22/h5-8,10-11,14-19,27,29H,1-2,9,12-13,20H2,3-4H3/b11-8-,19-10-,21-7+,25-24-,28-18+ |
| InChIKey | FNYHMGREZJYJNC-IVPNNQKDSA-N |
| XLogP | 5.93 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|