C14H17F7O3 — CID 89386043
[1-[1,3,3,3-tetrafluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylprop-2-enoate (PubChem CID 89386043) has the molecular formula C14H17F7O3 and a molecular weight of 366.27 g/mol. Its IUPAC name is [1-[1,3,3,3-tetrafluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylprop-2-enoate.
| Compound Name | [1-[1,3,3,3-tetrafluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89386043 |
| Molecular Formula | C14H17F7O3 |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | [1-[1,3,3,3-tetrafluoro-2-hydroxy-2-(trifluoromethyl)propyl]cyclohexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(C(F)C(O)(C(F)(F)F)C(F)(F)F)CCCCC1 |
| InChI | InChI=1S/C14H17F7O3/c1-8(2)9(22)24-11(6-4-3-5-7-11)10(15)12(23,13(16,17)18)14(19,20)21/h10,23H,1,3-7H2,2H3 |
| InChIKey | UOVSSHDOCPFLFB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|