About 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide
4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide (PubChem CID 8938609) has the molecular formula C17H24N2O4S
and a molecular weight of 352.46 g/mol. Its IUPAC name is 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide.
Molecular Properties
| Compound Name | 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide |
| PubChem CID | 8938609 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNC(=O)C[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-17(2,3)14-6-4-13(5-7-14)16(21)19-18-15(20)10-12-8-9-24(22,23)11-12/h4-7,12H,8-11H2,1-3H3,(H,18,20)(H,19,21)/t12-/m0/s1 |
| InChIKey | SNUJYEVAZQHZGA-LBPRGKRZSA-N |
| XLogP | 1.57 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide?
The IUPAC name of 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide (CID 8938609) is 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide.
What is the SMILES notation for 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide?
The canonical SMILES for 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide is CC(C)(C)c1ccc(C(=O)NNC(=O)C[C@@H]2CCS(=O)(=O)C2)cc1.
What is the InChIKey of 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide?
The InChIKey is SNUJYEVAZQHZGA-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H24N2O4S/c1-17(2,3)14-6-4-13(5-7-14)16(21)19-18-15(20)10-12-8-9-24(22,23)11-12/h4-7,12H,8-11H2,1-3H3,(H,18,20)(H,19,21)/t12-/m0/s1.
What are the key properties of 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide?
4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide has a molecular weight of 352.46 g/mol, XLogP of 1.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N'-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]benzohydrazide is sourced from PubChem (CID 8938609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).