C15H13ClIN5 — CID 89386167
7-[2-chloro-3-(iodomethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine (PubChem CID 89386167) has the molecular formula C15H13ClIN5 and a molecular weight of 425.66 g/mol. Its IUPAC name is 7-[2-chloro-3-(iodomethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 7-[2-chloro-3-(iodomethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 89386167 |
| Molecular Formula | C15H13ClIN5 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 7-[2-chloro-3-(iodomethyl)phenyl]-4-N-methylpyrido[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CNc1nc(N)nc2nc(-c3cccc(CI)c3Cl)ccc12 |
| InChI | InChI=1S/C15H13ClIN5/c1-19-13-10-5-6-11(20-14(10)22-15(18)21-13)9-4-2-3-8(7-17)12(9)16/h2-6H,7H2,1H3,(H3,18,19,20,21,22) |
| InChIKey | GMJBEHYBLGNOMH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|