About 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole
5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole (PubChem CID 89386331) has the molecular formula C7H8N2OS
and a molecular weight of 168.22 g/mol. Its IUPAC name is 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole.
Analyze 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole?
The IUPAC name of 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole (CID 89386331) is 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole.
What is the SMILES notation for 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole?
The canonical SMILES for 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole is Cc1noc(C2CC=CS2)n1.
What is the InChIKey of 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole?
The InChIKey is LWVAVTJOUMKSMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS/c1-5-8-7(10-9-5)6-3-2-4-11-6/h2,4,6H,3H2,1H3.
What are the key properties of 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole?
5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole has a molecular weight of 168.22 g/mol, XLogP of 2.07, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydrothiophen-2-yl)-3-methyl-1,2,4-oxadiazole is sourced from PubChem (CID 89386331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).