About (5S)-5-amino-2,6-dimethyloct-1-en-4-one
(5S)-5-amino-2,6-dimethyloct-1-en-4-one (PubChem CID 89386562) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is (5S)-5-amino-2,6-dimethyloct-1-en-4-one.
Molecular Properties
| Compound Name | (5S)-5-amino-2,6-dimethyloct-1-en-4-one |
| PubChem CID | 89386562 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (5S)-5-amino-2,6-dimethyloct-1-en-4-one |
| SMILES | C=C(C)CC(=O)[C@@H](N)C(C)CC |
| InChI | InChI=1S/C10H19NO/c1-5-8(4)10(11)9(12)6-7(2)3/h8,10H,2,5-6,11H2,1,3-4H3/t8?,10-/m0/s1 |
| InChIKey | LPERNXPVIIIEHF-HTLJXXAVSA-N |
| XLogP | 1.90 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-amino-2,6-dimethyloct-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-amino-2,6-dimethyloct-1-en-4-one?
The IUPAC name of (5S)-5-amino-2,6-dimethyloct-1-en-4-one (CID 89386562) is (5S)-5-amino-2,6-dimethyloct-1-en-4-one.
What is the SMILES notation for (5S)-5-amino-2,6-dimethyloct-1-en-4-one?
The canonical SMILES for (5S)-5-amino-2,6-dimethyloct-1-en-4-one is C=C(C)CC(=O)[C@@H](N)C(C)CC.
What is the InChIKey of (5S)-5-amino-2,6-dimethyloct-1-en-4-one?
The InChIKey is LPERNXPVIIIEHF-HTLJXXAVSA-N. The full InChI is InChI=1S/C10H19NO/c1-5-8(4)10(11)9(12)6-7(2)3/h8,10H,2,5-6,11H2,1,3-4H3/t8?,10-/m0/s1.
What are the key properties of (5S)-5-amino-2,6-dimethyloct-1-en-4-one?
(5S)-5-amino-2,6-dimethyloct-1-en-4-one has a molecular weight of 169.27 g/mol, XLogP of 1.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-amino-2,6-dimethyloct-1-en-4-one is sourced from PubChem (CID 89386562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).