C18H27NO — CID 89386578
7-[4-[(1Z)-buta-1,3-dienyl]-2,3,5-trimethylpyrrol-3-yl]heptan-2-one (PubChem CID 89386578) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 7-[4-[(1Z)-buta-1,3-dienyl]-2,3,5-trimethylpyrrol-3-yl]heptan-2-one.
| Compound Name | 7-[4-[(1Z)-buta-1,3-dienyl]-2,3,5-trimethylpyrrol-3-yl]heptan-2-one |
|---|---|
| PubChem CID | 89386578 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 7-[4-[(1Z)-buta-1,3-dienyl]-2,3,5-trimethylpyrrol-3-yl]heptan-2-one |
| SMILES | C=C/C=C\C1=C(C)N=C(C)C1(C)CCCCCC(C)=O |
| InChI | InChI=1S/C18H27NO/c1-6-7-12-17-15(3)19-16(4)18(17,5)13-10-8-9-11-14(2)20/h6-7,12H,1,8-11,13H2,2-5H3/b12-7- |
| InChIKey | AAEBFGXOZPUQRC-GHXNOFRVSA-N |
| XLogP | 5.02 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|