C24H46O3SSi — CID 89386582
[(1R,3aR,4S,7aR)-1-[(E,2S)-4-tert-butylsulfonylbut-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane (PubChem CID 89386582) has the molecular formula C24H46O3SSi and a molecular weight of 442.78 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(E,2S)-4-tert-butylsulfonylbut-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(E,2S)-4-tert-butylsulfonylbut-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 89386582 |
| Molecular Formula | C24H46O3SSi |
| Molecular Weight | 442.78 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(E,2S)-4-tert-butylsulfonylbut-3-en-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)[C@@H]([C@H](C)/C=C/S(=O)(=O)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C24H46O3SSi/c1-9-29(10-2,11-3)27-22-13-12-17-24(8)20(14-15-21(22)24)19(4)16-18-28(25,26)23(5,6)7/h16,18-22H,9-15,17H2,1-8H3/b18-16+/t19-,20-,21+,22+,24-/m1/s1 |
| InChIKey | JXHWHNOHAWVOHY-MMHJDMDMSA-N |
| XLogP | 6.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.78 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|