About 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole
5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole (PubChem CID 89386699) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole |
| PubChem CID | 89386699 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole |
| SMILES | C=CC1=C(/C=C\C)NCO1 |
| InChI | InChI=1S/C8H11NO/c1-3-5-7-8(4-2)10-6-9-7/h3-5,9H,2,6H2,1H3/b5-3- |
| InChIKey | KVQGXSZSPSHRMT-HYXAFXHYSA-N |
| XLogP | 1.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole?
The IUPAC name of 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole (CID 89386699) is 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole.
What is the SMILES notation for 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole?
The canonical SMILES for 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole is C=CC1=C(/C=C\C)NCO1.
What is the InChIKey of 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole?
The InChIKey is KVQGXSZSPSHRMT-HYXAFXHYSA-N. The full InChI is InChI=1S/C8H11NO/c1-3-5-7-8(4-2)10-6-9-7/h3-5,9H,2,6H2,1H3/b5-3-.
What are the key properties of 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole?
5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole has a molecular weight of 137.18 g/mol, XLogP of 1.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-4-[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole is sourced from PubChem (CID 89386699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).