About imidazo[1,5-a][1,3,5]triazine-2-carbonitrile
imidazo[1,5-a][1,3,5]triazine-2-carbonitrile (PubChem CID 89386874) has the molecular formula C6H3N5
and a molecular weight of 145.12 g/mol. Its IUPAC name is imidazo[1,5-a][1,3,5]triazine-2-carbonitrile.
Molecular Properties
| Compound Name | imidazo[1,5-a][1,3,5]triazine-2-carbonitrile |
| PubChem CID | 89386874 |
| Molecular Formula | C6H3N5 |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | imidazo[1,5-a][1,3,5]triazine-2-carbonitrile |
| SMILES | N#Cc1ncn2cncc2n1 |
| InChI | InChI=1S/C6H3N5/c7-1-5-9-4-11-3-8-2-6(11)10-5/h2-4H |
| InChIKey | PZSOBDIEFJGZBQ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze imidazo[1,5-a][1,3,5]triazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,5-a][1,3,5]triazine-2-carbonitrile?
The IUPAC name of imidazo[1,5-a][1,3,5]triazine-2-carbonitrile (CID 89386874) is imidazo[1,5-a][1,3,5]triazine-2-carbonitrile.
What is the SMILES notation for imidazo[1,5-a][1,3,5]triazine-2-carbonitrile?
The canonical SMILES for imidazo[1,5-a][1,3,5]triazine-2-carbonitrile is N#Cc1ncn2cncc2n1.
What is the InChIKey of imidazo[1,5-a][1,3,5]triazine-2-carbonitrile?
The InChIKey is PZSOBDIEFJGZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N5/c7-1-5-9-4-11-3-8-2-6(11)10-5/h2-4H.
What are the key properties of imidazo[1,5-a][1,3,5]triazine-2-carbonitrile?
imidazo[1,5-a][1,3,5]triazine-2-carbonitrile has a molecular weight of 145.12 g/mol, XLogP of -0.00, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,5-a][1,3,5]triazine-2-carbonitrile is sourced from PubChem (CID 89386874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).