About 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline
4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline (PubChem CID 89386903) has the molecular formula C12H15NS
and a molecular weight of 205.33 g/mol. Its IUPAC name is 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline.
Molecular Properties
| Compound Name | 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline |
| PubChem CID | 89386903 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline |
| SMILES | C=C/C=C(/C)SCc1ccc(N)cc1 |
| InChI | InChI=1S/C12H15NS/c1-3-4-10(2)14-9-11-5-7-12(13)8-6-11/h3-8H,1,9,13H2,2H3/b10-4- |
| InChIKey | BVASPEZDDWAQLH-WMZJFQQLSA-N |
| XLogP | 3.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline?
The IUPAC name of 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline (CID 89386903) is 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline.
What is the SMILES notation for 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline?
The canonical SMILES for 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline is C=C/C=C(/C)SCc1ccc(N)cc1.
What is the InChIKey of 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline?
The InChIKey is BVASPEZDDWAQLH-WMZJFQQLSA-N. The full InChI is InChI=1S/C12H15NS/c1-3-4-10(2)14-9-11-5-7-12(13)8-6-11/h3-8H,1,9,13H2,2H3/b10-4-.
What are the key properties of 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline?
4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline has a molecular weight of 205.33 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2Z)-penta-2,4-dien-2-yl]sulfanylmethyl]aniline is sourced from PubChem (CID 89386903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).