C13H21NO — CID 89387099
(2Z,4E)-4-isocyanato-7,9-dimethyldeca-2,4-diene (PubChem CID 89387099) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (2Z,4E)-4-isocyanato-7,9-dimethyldeca-2,4-diene.
| Compound Name | (2Z,4E)-4-isocyanato-7,9-dimethyldeca-2,4-diene |
|---|---|
| PubChem CID | 89387099 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (2Z,4E)-4-isocyanato-7,9-dimethyldeca-2,4-diene |
| SMILES | C/C=C\C(=C/CC(C)CC(C)C)N=C=O |
| InChI | InChI=1S/C13H21NO/c1-5-6-13(14-10-15)8-7-12(4)9-11(2)3/h5-6,8,11-12H,7,9H2,1-4H3/b6-5-,13-8+ |
| InChIKey | HARLXAMAYQUADP-AVHOOITRSA-N |
| XLogP | 3.85 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|