C37H42N7O2+ — CID 89387349
4-[3-[(1R)-1-(1-adamantyl)-1-formylpiperidin-1-ium-3-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]-N-(4-cyclopropyl-2-pyridinyl)benzamide (PubChem CID 89387349) has the molecular formula C37H42N7O2+ and a molecular weight of 616.79 g/mol. Its IUPAC name is 4-[3-[(1R)-1-(1-adamantyl)-1-formylpiperidin-1-ium-3-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]-N-(4-cyclopropyl-2-pyridinyl)benzamide.
| Compound Name | 4-[3-[(1R)-1-(1-adamantyl)-1-formylpiperidin-1-ium-3-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]-N-(4-cyclopropyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 89387349 |
| Molecular Formula | C37H42N7O2+ |
| Molecular Weight | 616.79 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | 4-[3-[(1R)-1-(1-adamantyl)-1-formylpiperidin-1-ium-3-yl]-8-aminoimidazo[1,5-a]pyrazin-1-yl]-N-(4-cyclopropyl-2-pyridinyl)benzamide |
| SMILES | Nc1nccn2c(C3CCC[N@+](C=O)(C45CC6CC(CC(C6)C4)C5)C3)nc(-c3ccc(C(=O)Nc4cc(C5CC5)ccn4)cc3)c12 |
| InChI | InChI=1S/C37H41N7O2/c38-34-33-32(27-5-7-28(8-6-27)36(46)41-31-17-29(9-10-39-31)26-3-4-26)42-35(43(33)12-11-40-34)30-2-1-13-44(21-30,22-45)37-18-23-14-24(19-37)16-25(15-23)20-37/h5-12,17,22-26,30H,1-4,13-16,18-21H2,(H2-,38,39,40,41,46)/p+1/t23?,24?,25?,30?,37?,44-/m0/s1 |
| InChIKey | ZWASXHIXQHLSNQ-NPEYAOCRSA-O |
| XLogP | 6.32 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.79 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|