About 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde
3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 89387721) has the molecular formula C7H5NO2
and a molecular weight of 135.12 g/mol. Its IUPAC name is 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 89387721 |
| Molecular Formula | C7H5NO2 |
| Molecular Weight | 135.12 g/mol |
| Exact Mass | 135.03 |
| IUPAC Name | 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | [H]/N=C1\C=C(C=O)C=CC1=O |
| InChI | InChI=1S/C7H5NO2/c8-6-3-5(4-9)1-2-7(6)10/h1-4,8H/b8-6+ |
| InChIKey | BPPUYAKCBXXIGS-SOFGYWHQSA-N |
| XLogP | 0.27 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.12 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde (CID 89387721) is 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde is [H]/N=C1\C=C(C=O)C=CC1=O.
What is the InChIKey of 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is BPPUYAKCBXXIGS-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H5NO2/c8-6-3-5(4-9)1-2-7(6)10/h1-4,8H/b8-6+.
What are the key properties of 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde?
3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 135.12 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 89387721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).