About 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron
3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron (PubChem CID 89387762) has the molecular formula C7H5FeNO2
and a molecular weight of 190.97 g/mol. Its IUPAC name is 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron.
Molecular Properties
| Compound Name | 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron |
| PubChem CID | 89387762 |
| Molecular Formula | C7H5FeNO2 |
| Molecular Weight | 190.97 g/mol |
| Exact Mass | 190.97 |
| IUPAC Name | 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron |
| SMILES | [Fe].[H]/N=C1\C=C(C=O)C=CC1=O |
| InChI | InChI=1S/C7H5NO2.Fe/c8-6-3-5(4-9)1-2-7(6)10;/h1-4,8H;/b8-6+; |
| InChIKey | BEICPCQVZVQYRO-WVLIHFOGSA-N |
| XLogP | 0.27 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.97 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron?
The IUPAC name of 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron (CID 89387762) is 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron.
What is the SMILES notation for 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron?
The canonical SMILES for 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron is [Fe].[H]/N=C1\C=C(C=O)C=CC1=O.
What is the InChIKey of 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron?
The InChIKey is BEICPCQVZVQYRO-WVLIHFOGSA-N. The full InChI is InChI=1S/C7H5NO2.Fe/c8-6-3-5(4-9)1-2-7(6)10;/h1-4,8H;/b8-6+;.
What are the key properties of 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron?
3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron has a molecular weight of 190.97 g/mol, XLogP of 0.27, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-4-oxocyclohexa-1,5-diene-1-carbaldehyde;iron is sourced from PubChem (CID 89387762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).