C22H32N4OS — CID 8938885
(2R)-N-tert-butyl-2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 8938885) has the molecular formula C22H32N4OS and a molecular weight of 400.59 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-tert-butyl-2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 8938885 |
| Molecular Formula | C22H32N4OS |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (2R)-N-tert-butyl-2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)NC(C)(C)C)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H32N4OS/c1-9-14-26-18(16-10-12-17(13-11-16)21(3,4)5)24-25-20(26)28-15(2)19(27)23-22(6,7)8/h9-13,15H,1,14H2,2-8H3,(H,23,27)/t15-/m1/s1 |
| InChIKey | KMKWGFKPFMVFCF-OAHLLOKOSA-N |
| XLogP | 4.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|