C18H24FN3O5S — CID 8938900
N-[(2S)-1-[2-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide (PubChem CID 8938900) has the molecular formula C18H24FN3O5S and a molecular weight of 413.47 g/mol. Its IUPAC name is N-[(2S)-1-[2-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-1-[2-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 8938900 |
| Molecular Formula | C18H24FN3O5S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[(2S)-1-[2-[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]hydrazinyl]-3-methyl-1-oxobutan-2-yl]-4-fluorobenzamide |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(F)cc1)C(=O)NNC(=O)C[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H24FN3O5S/c1-11(2)16(20-17(24)13-3-5-14(19)6-4-13)18(25)22-21-15(23)9-12-7-8-28(26,27)10-12/h3-6,11-12,16H,7-10H2,1-2H3,(H,20,24)(H,21,23)(H,22,25)/t12-,16-/m0/s1 |
| InChIKey | GHAWBUJKETUGJM-LRDDRELGSA-N |
| XLogP | 0.55 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|