C6H2F5O2S- — CID 89389989
(1Z,3Z,5Z)-1,2,4,5,6-pentafluorohexa-1,3,5-triene-3-sulfinate (PubChem CID 89389989) has the molecular formula C6H2F5O2S- and a molecular weight of 233.14 g/mol. Its IUPAC name is (1Z,3Z,5Z)-1,2,4,5,6-pentafluorohexa-1,3,5-triene-3-sulfinate.
| Compound Name | (1Z,3Z,5Z)-1,2,4,5,6-pentafluorohexa-1,3,5-triene-3-sulfinate |
|---|---|
| PubChem CID | 89389989 |
| Molecular Formula | C6H2F5O2S- |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 232.97 |
| IUPAC Name | (1Z,3Z,5Z)-1,2,4,5,6-pentafluorohexa-1,3,5-triene-3-sulfinate |
| SMILES | O=S([O-])C(/C(F)=C/F)=C(F)/C(F)=C/F |
| InChI | InChI=1S/C6H3F5O2S/c7-1-3(9)5(11)6(14(12)13)4(10)2-8/h1-2H,(H,12,13)/p-1/b3-1-,4-2-,6-5- |
| InChIKey | OPMFCYXWAANKCM-FWNKLROWSA-M |
| XLogP | 2.61 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|