C27H38BN3O5 — CID 89390063
CID 89390063 (PubChem CID 89390063) has the molecular formula C27H38BN3O5 and a molecular weight of 495.43 g/mol.
| Compound Name | CID 89390063 |
|---|---|
| PubChem CID | 89390063 |
| Molecular Formula | C27H38BN3O5 |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.29 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@H](Cc1ccc(OCCCC)cc1)[C@H](O)CN(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H38BN3O5/c1-5-6-16-35-22-14-12-20(13-15-22)17-23(29-25(28)33)24(32)19-31(18-21-10-8-7-9-11-21)30-26(34)36-27(2,3)4/h7-15,23-24,32H,5-6,16-19H2,1-4H3,(H,29,33)(H,30,34)/t23-,24-/m1/s1 |
| InChIKey | GARXFIGOCHOUMK-DNQXCXABSA-N |
| XLogP | 3.96 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|