About CID 89390199
CID 89390199 (PubChem CID 89390199) has the molecular formula C10H21OS3-
and a molecular weight of 253.48 g/mol.
Molecular Properties
| Compound Name | CID 89390199 |
| PubChem CID | 89390199 |
| Molecular Formula | C10H21OS3- |
| Molecular Weight | 253.48 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | — |
| SMILES | CCCCCCC(CCC)O[S-](=S)=S |
| InChI | InChI=1S/C10H21OS3/c1-3-5-6-7-9-10(8-4-2)11-14(12)13/h10H,3-9H2,1-2H3/q-1 |
| InChIKey | GHWVJGWGZRHNQS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 89390199 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89390199?
The IUPAC name of CID 89390199 (CID 89390199) is not available.
What is the SMILES notation for CID 89390199?
The canonical SMILES for CID 89390199 is CCCCCCC(CCC)O[S-](=S)=S.
What is the InChIKey of CID 89390199?
The InChIKey is GHWVJGWGZRHNQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21OS3/c1-3-5-6-7-9-10(8-4-2)11-14(12)13/h10H,3-9H2,1-2H3/q-1.
What are the key properties of CID 89390199?
CID 89390199 has a molecular weight of 253.48 g/mol, XLogP of 3.60, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89390199 is sourced from PubChem (CID 89390199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).