About 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one
5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one (PubChem CID 89390221) has the molecular formula C11H11NO
and a molecular weight of 173.21 g/mol. Its IUPAC name is 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one |
| PubChem CID | 89390221 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one |
| SMILES | C=C(C)c1ccc2c(c1)CNC2=O |
| InChI | InChI=1S/C11H11NO/c1-7(2)8-3-4-10-9(5-8)6-12-11(10)13/h3-5H,1,6H2,2H3,(H,12,13) |
| InChIKey | BTLSDSLENJNWNK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one?
The IUPAC name of 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one (CID 89390221) is 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one?
The canonical SMILES for 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one is C=C(C)c1ccc2c(c1)CNC2=O.
What is the InChIKey of 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one?
The InChIKey is BTLSDSLENJNWNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO/c1-7(2)8-3-4-10-9(5-8)6-12-11(10)13/h3-5H,1,6H2,2H3,(H,12,13).
What are the key properties of 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one?
5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one has a molecular weight of 173.21 g/mol, XLogP of 1.96, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-1-en-2-yl-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 89390221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).