C13H24N2 — CID 89390271
(3Z,5E)-N,4,6-trimethyl-9-methyliminonona-3,5-dien-5-amine (PubChem CID 89390271) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (3Z,5E)-N,4,6-trimethyl-9-methyliminonona-3,5-dien-5-amine.
| Compound Name | (3Z,5E)-N,4,6-trimethyl-9-methyliminonona-3,5-dien-5-amine |
|---|---|
| PubChem CID | 89390271 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (3Z,5E)-N,4,6-trimethyl-9-methyliminonona-3,5-dien-5-amine |
| SMILES | CC/C=C(C)\C(NC)=C(\C)CC/C=N/C |
| InChI | InChI=1S/C13H24N2/c1-6-8-11(2)13(15-5)12(3)9-7-10-14-4/h8,10,15H,6-7,9H2,1-5H3/b11-8-,13-12+,14-10+ |
| InChIKey | ZSCJJUQBIVSUSH-AOQPUXRJSA-N |
| XLogP | 3.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|