C27H25Cl2IN4O — CID 89390341
(3R,4R)-2-(2,4-dichlorophenyl)-3-[4-(iodomethyl)phenyl]-4-methyl-N-(2-methyl-2,3-dihydroindol-1-yl)-3,4-dihydropyrazole-5-carboxamide (PubChem CID 89390341) has the molecular formula C27H25Cl2IN4O and a molecular weight of 619.33 g/mol. Its IUPAC name is (3R,4R)-2-(2,4-dichlorophenyl)-3-[4-(iodomethyl)phenyl]-4-methyl-N-(2-methyl-2,3-dihydroindol-1-yl)-3,4-dihydropyrazole-5-carboxamide.
| Compound Name | (3R,4R)-2-(2,4-dichlorophenyl)-3-[4-(iodomethyl)phenyl]-4-methyl-N-(2-methyl-2,3-dihydroindol-1-yl)-3,4-dihydropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 89390341 |
| Molecular Formula | C27H25Cl2IN4O |
| Molecular Weight | 619.33 g/mol |
| Exact Mass | 618.05 |
| IUPAC Name | (3R,4R)-2-(2,4-dichlorophenyl)-3-[4-(iodomethyl)phenyl]-4-methyl-N-(2-methyl-2,3-dihydroindol-1-yl)-3,4-dihydropyrazole-5-carboxamide |
| SMILES | CC1Cc2ccccc2N1NC(=O)C1=NN(c2ccc(Cl)cc2Cl)[C@@H](c2ccc(CI)cc2)[C@H]1C |
| InChI | InChI=1S/C27H25Cl2IN4O/c1-16-13-20-5-3-4-6-23(20)33(16)32-27(35)25-17(2)26(19-9-7-18(15-30)8-10-19)34(31-25)24-12-11-21(28)14-22(24)29/h3-12,14,16-17,26H,13,15H2,1-2H3,(H,32,35)/t16?,17-,26+/m0/s1 |
| InChIKey | ZKQYZCGGEBNEGG-IELURWDFSA-N |
| XLogP | 6.96 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.33 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|