About [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane
[2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane (PubChem CID 89390369) has the molecular formula C13H21F7S
and a molecular weight of 342.36 g/mol. Its IUPAC name is [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane |
| PubChem CID | 89390369 |
| Molecular Formula | C13H21F7S |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane |
| SMILES | CC1CCC(C2CC(F)C(S(F)(F)(F)(F)F)C(F)C2)CC1 |
| InChI | InChI=1S/C13H21F7S/c1-8-2-4-9(5-3-8)10-6-11(14)13(12(15)7-10)21(16,17,18,19)20/h8-13H,2-7H2,1H3 |
| InChIKey | KARKYDNKEBNZPX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane?
The IUPAC name of [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane (CID 89390369) is [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane.
What is the SMILES notation for [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane?
The canonical SMILES for [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane is CC1CCC(C2CC(F)C(S(F)(F)(F)(F)F)C(F)C2)CC1.
What is the InChIKey of [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane?
The InChIKey is KARKYDNKEBNZPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F7S/c1-8-2-4-9(5-3-8)10-6-11(14)13(12(15)7-10)21(16,17,18,19)20/h8-13H,2-7H2,1H3.
What are the key properties of [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane?
[2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane has a molecular weight of 342.36 g/mol, XLogP of 6.57, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-difluoro-4-(4-methylcyclohexyl)cyclohexyl]-pentafluoro-λ6-sulfane is sourced from PubChem (CID 89390369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).