C9H17O2P — CID 89390442
(2R,3S,4S)-2,4-dimethyl-3-phosphanyloxyhept-6-enal (PubChem CID 89390442) has the molecular formula C9H17O2P and a molecular weight of 188.21 g/mol. Its IUPAC name is (2R,3S,4S)-2,4-dimethyl-3-phosphanyloxyhept-6-enal.
| Compound Name | (2R,3S,4S)-2,4-dimethyl-3-phosphanyloxyhept-6-enal |
|---|---|
| PubChem CID | 89390442 |
| Molecular Formula | C9H17O2P |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (2R,3S,4S)-2,4-dimethyl-3-phosphanyloxyhept-6-enal |
| SMILES | C=CC[C@H](C)[C@H](OP)C(C)C=O |
| InChI | InChI=1S/C9H17O2P/c1-4-5-7(2)9(11-12)8(3)6-10/h4,6-9H,1,5,12H2,2-3H3/t7-,8?,9-/m0/s1 |
| InChIKey | QJJQRPWSRIIDBI-SMOXQLQSSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|