About 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone
1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone (PubChem CID 89390528) has the molecular formula C9H11ClO2
and a molecular weight of 186.64 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone |
| PubChem CID | 89390528 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone |
| SMILES | COC1C=CC(C(C)=O)=CC1Cl |
| InChI | InChI=1S/C9H11ClO2/c1-6(11)7-3-4-9(12-2)8(10)5-7/h3-5,8-9H,1-2H3 |
| InChIKey | YDGFVCPVBRSYAV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone?
The IUPAC name of 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone (CID 89390528) is 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone.
What is the SMILES notation for 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone?
The canonical SMILES for 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone is COC1C=CC(C(C)=O)=CC1Cl.
What is the InChIKey of 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone?
The InChIKey is YDGFVCPVBRSYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO2/c1-6(11)7-3-4-9(12-2)8(10)5-7/h3-5,8-9H,1-2H3.
What are the key properties of 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone?
1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone has a molecular weight of 186.64 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloro-4-methoxycyclohexa-1,5-dien-1-yl)ethanone is sourced from PubChem (CID 89390528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).